C25H22N4S — CID 4637384
1-tert-butyl-3-phenanthro[9,10-b]quinoxalin-11-ylthiourea (PubChem CID 4637384) has the molecular formula C25H22N4S and a molecular weight of 410.55 g/mol. Its IUPAC name is 1-tert-butyl-3-phenanthro[9,10-b]quinoxalin-11-ylthiourea.
| Compound Name | 1-tert-butyl-3-phenanthro[9,10-b]quinoxalin-11-ylthiourea |
|---|---|
| PubChem CID | 4637384 |
| Molecular Formula | C25H22N4S |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-tert-butyl-3-phenanthro[9,10-b]quinoxalin-11-ylthiourea |
| SMILES | CC(C)(C)NC(=S)Nc1ccc2nc3c4ccccc4c4ccccc4c3nc2c1 |
| InChI | InChI=1S/C25H22N4S/c1-25(2,3)29-24(30)26-15-12-13-20-21(14-15)28-23-19-11-7-5-9-17(19)16-8-4-6-10-18(16)22(23)27-20/h4-14H,1-3H3,(H2,26,29,30) |
| InChIKey | PRLTZIHRFPAFTJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|