C22H18N4O2S — CID 126004026
1-benzyl-3-(2,3-dihydro-[1,4]dioxino[2,3-b]phenazin-8-yl)thiourea (PubChem CID 126004026) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is 1-benzyl-3-(2,3-dihydro-[1,4]dioxino[2,3-b]phenazin-8-yl)thiourea.
| Compound Name | 1-benzyl-3-(2,3-dihydro-[1,4]dioxino[2,3-b]phenazin-8-yl)thiourea |
|---|---|
| PubChem CID | 126004026 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 1-benzyl-3-(2,3-dihydro-[1,4]dioxino[2,3-b]phenazin-8-yl)thiourea |
| SMILES | S=C(NCc1ccccc1)Nc1ccc2nc3cc4c(cc3nc2c1)OCCO4 |
| InChI | InChI=1S/C22H18N4O2S/c29-22(23-13-14-4-2-1-3-5-14)24-15-6-7-16-17(10-15)26-19-12-21-20(11-18(19)25-16)27-8-9-28-21/h1-7,10-12H,8-9,13H2,(H2,23,24,29) |
| InChIKey | OJHCZNICPHNLMZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|