C23H20N4O2S — CID 126004663
1-(2,3-dihydro-[1,4]dioxino[2,3-b]phenazin-8-yl)-3-(3,4-dimethylphenyl)thiourea (PubChem CID 126004663) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is 1-(2,3-dihydro-[1,4]dioxino[2,3-b]phenazin-8-yl)-3-(3,4-dimethylphenyl)thiourea.
| Compound Name | 1-(2,3-dihydro-[1,4]dioxino[2,3-b]phenazin-8-yl)-3-(3,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 126004663 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-(2,3-dihydro-[1,4]dioxino[2,3-b]phenazin-8-yl)-3-(3,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc3nc4cc5c(cc4nc3c2)OCCO5)cc1C |
| InChI | InChI=1S/C23H20N4O2S/c1-13-3-4-15(9-14(13)2)24-23(30)25-16-5-6-17-18(10-16)27-20-12-22-21(11-19(20)26-17)28-7-8-29-22/h3-6,9-12H,7-8H2,1-2H3,(H2,24,25,30) |
| InChIKey | QAYZQRFRHNOMST-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|