C15H14N4S — CID 3959074
1,1-dimethyl-3-phenazin-2-ylthiourea (PubChem CID 3959074) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is 1,1-dimethyl-3-phenazin-2-ylthiourea.
| Compound Name | 1,1-dimethyl-3-phenazin-2-ylthiourea |
|---|---|
| PubChem CID | 3959074 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1,1-dimethyl-3-phenazin-2-ylthiourea |
| SMILES | CN(C)C(=S)Nc1ccc2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C15H14N4S/c1-19(2)15(20)16-10-7-8-13-14(9-10)18-12-6-4-3-5-11(12)17-13/h3-9H,1-2H3,(H,16,20) |
| InChIKey | TZWUGABAZXBNKQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|