C21H19N5O2S — CID 126000432
1-anilino-3-(7,8-dimethoxyphenazin-2-yl)thiourea (PubChem CID 126000432) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is 1-anilino-3-(7,8-dimethoxyphenazin-2-yl)thiourea.
| Compound Name | 1-anilino-3-(7,8-dimethoxyphenazin-2-yl)thiourea |
|---|---|
| PubChem CID | 126000432 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 1-anilino-3-(7,8-dimethoxyphenazin-2-yl)thiourea |
| SMILES | COc1cc2nc3ccc(NC(=S)NNc4ccccc4)cc3nc2cc1OC |
| InChI | InChI=1S/C21H19N5O2S/c1-27-19-11-17-18(12-20(19)28-2)24-16-10-14(8-9-15(16)23-17)22-21(29)26-25-13-6-4-3-5-7-13/h3-12,25H,1-2H3,(H2,22,26,29) |
| InChIKey | FZQDHCWEJUWATH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|