C19H20N4O2S2 — CID 126001921
N-(7,8-dimethoxyphenazin-2-yl)thiomorpholine-4-carbothioamide (PubChem CID 126001921) has the molecular formula C19H20N4O2S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-(7,8-dimethoxyphenazin-2-yl)thiomorpholine-4-carbothioamide.
| Compound Name | N-(7,8-dimethoxyphenazin-2-yl)thiomorpholine-4-carbothioamide |
|---|---|
| PubChem CID | 126001921 |
| Molecular Formula | C19H20N4O2S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-(7,8-dimethoxyphenazin-2-yl)thiomorpholine-4-carbothioamide |
| SMILES | COc1cc2nc3ccc(NC(=S)N4CCSCC4)cc3nc2cc1OC |
| InChI | InChI=1S/C19H20N4O2S2/c1-24-17-10-15-16(11-18(17)25-2)22-14-9-12(3-4-13(14)21-15)20-19(26)23-5-7-27-8-6-23/h3-4,9-11H,5-8H2,1-2H3,(H,20,26) |
| InChIKey | LWKVSFFKMDTLPY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|