C12H15ClN2O2S2 — CID 23966556
N-(4-chloro-2,5-dimethoxyphenyl)-1,3-thiazolidine-3-carbothioamide (PubChem CID 23966556) has the molecular formula C12H15ClN2O2S2 and a molecular weight of 318.85 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-1,3-thiazolidine-3-carbothioamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 23966556 |
| Molecular Formula | C12H15ClN2O2S2 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-1,3-thiazolidine-3-carbothioamide |
| SMILES | COc1cc(NC(=S)N2CCSC2)c(OC)cc1Cl |
| InChI | InChI=1S/C12H15ClN2O2S2/c1-16-10-6-9(11(17-2)5-8(10)13)14-12(18)15-3-4-19-7-15/h5-6H,3-4,7H2,1-2H3,(H,14,18) |
| InChIKey | JPOLHQJBTJKNLR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|