C14H18ClN3O3S — CID 3456143
N-(4-chloro-2,5-dimethoxyphenyl)-4-formylpiperazine-1-carbothioamide (PubChem CID 3456143) has the molecular formula C14H18ClN3O3S and a molecular weight of 343.84 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-4-formylpiperazine-1-carbothioamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-formylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3456143 |
| Molecular Formula | C14H18ClN3O3S |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-formylpiperazine-1-carbothioamide |
| SMILES | COc1cc(NC(=S)N2CCN(C=O)CC2)c(OC)cc1Cl |
| InChI | InChI=1S/C14H18ClN3O3S/c1-20-12-8-11(13(21-2)7-10(12)15)16-14(22)18-5-3-17(9-19)4-6-18/h7-9H,3-6H2,1-2H3,(H,16,22) |
| InChIKey | FQNUSIDUGBZMPK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|