C22H27ClN4O3S — CID 3507302
2-[4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-phenylacetamide (PubChem CID 3507302) has the molecular formula C22H27ClN4O3S and a molecular weight of 463.00 g/mol. Its IUPAC name is 2-[4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 3507302 |
| Molecular Formula | C22H27ClN4O3S |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-[4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-phenylacetamide |
| SMILES | COc1cc(NC(=S)N2CCCN(CC(=O)Nc3ccccc3)CC2)c(OC)cc1Cl |
| InChI | InChI=1S/C22H27ClN4O3S/c1-29-19-14-18(20(30-2)13-17(19)23)25-22(31)27-10-6-9-26(11-12-27)15-21(28)24-16-7-4-3-5-8-16/h3-5,7-8,13-14H,6,9-12,15H2,1-2H3,(H,24,28)(H,25,31) |
| InChIKey | UAPOJRHNWUCSSR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|