C19H23ClN4O2S — CID 100571049
N-(4-chloro-2,5-dimethoxyphenyl)-4-(pyridin-2-ylmethyl)piperazine-1-carbothioamide (PubChem CID 100571049) has the molecular formula C19H23ClN4O2S and a molecular weight of 406.94 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-4-(pyridin-2-ylmethyl)piperazine-1-carbothioamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-(pyridin-2-ylmethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 100571049 |
| Molecular Formula | C19H23ClN4O2S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-(pyridin-2-ylmethyl)piperazine-1-carbothioamide |
| SMILES | COc1cc(NC(=S)N2CCN(Cc3ccccn3)CC2)c(OC)cc1Cl |
| InChI | InChI=1S/C19H23ClN4O2S/c1-25-17-12-16(18(26-2)11-15(17)20)22-19(27)24-9-7-23(8-10-24)13-14-5-3-4-6-21-14/h3-6,11-12H,7-10,13H2,1-2H3,(H,22,27) |
| InChIKey | FAMXAUQPFOSNEH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|