C20H21ClN4O2S — CID 3419833
N-(4-chloro-2,5-dimethoxyphenyl)-4-(4-cyanophenyl)piperazine-1-carbothioamide (PubChem CID 3419833) has the molecular formula C20H21ClN4O2S and a molecular weight of 416.93 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-4-(4-cyanophenyl)piperazine-1-carbothioamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-(4-cyanophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3419833 |
| Molecular Formula | C20H21ClN4O2S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-(4-cyanophenyl)piperazine-1-carbothioamide |
| SMILES | COc1cc(NC(=S)N2CCN(c3ccc(C#N)cc3)CC2)c(OC)cc1Cl |
| InChI | InChI=1S/C20H21ClN4O2S/c1-26-18-12-17(19(27-2)11-16(18)21)23-20(28)25-9-7-24(8-10-25)15-5-3-14(13-22)4-6-15/h3-6,11-12H,7-10H2,1-2H3,(H,23,28) |
| InChIKey | KAHHUKDAHPLLSJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 60.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|