C19H22N4O4S — CID 19654554
N-(2-methoxy-4-nitrophenyl)-4-(4-methoxyphenyl)piperazine-1-carbothioamide (PubChem CID 19654554) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is N-(2-methoxy-4-nitrophenyl)-4-(4-methoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | N-(2-methoxy-4-nitrophenyl)-4-(4-methoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19654554 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-(2-methoxy-4-nitrophenyl)-4-(4-methoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccc(N2CCN(C(=S)Nc3ccc([N+](=O)[O-])cc3OC)CC2)cc1 |
| InChI | InChI=1S/C19H22N4O4S/c1-26-16-6-3-14(4-7-16)21-9-11-22(12-10-21)19(28)20-17-8-5-15(23(24)25)13-18(17)27-2/h3-8,13H,9-12H2,1-2H3,(H,20,28) |
| InChIKey | DXQHESGWQXLFHK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 80.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|