C17H17N5O4S — CID 3463932
N,4-bis(4-nitrophenyl)piperazine-1-carbothioamide (PubChem CID 3463932) has the molecular formula C17H17N5O4S and a molecular weight of 387.42 g/mol. Its IUPAC name is N,4-bis(4-nitrophenyl)piperazine-1-carbothioamide.
| Compound Name | N,4-bis(4-nitrophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3463932 |
| Molecular Formula | C17H17N5O4S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | N,4-bis(4-nitrophenyl)piperazine-1-carbothioamide |
| SMILES | O=[N+]([O-])c1ccc(NC(=S)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)cc1 |
| InChI | InChI=1S/C17H17N5O4S/c23-21(24)15-3-1-13(2-4-15)18-17(27)20-11-9-19(10-12-20)14-5-7-16(8-6-14)22(25)26/h1-8H,9-12H2,(H,18,27) |
| InChIKey | LIANXZTWYZSZPH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|