C18H18F2N4O3S — CID 2927103
N-[3-(difluoromethoxy)phenyl]-4-(4-nitrophenyl)piperazine-1-carbothioamide (PubChem CID 2927103) has the molecular formula C18H18F2N4O3S and a molecular weight of 408.43 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)phenyl]-4-(4-nitrophenyl)piperazine-1-carbothioamide.
| Compound Name | N-[3-(difluoromethoxy)phenyl]-4-(4-nitrophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2927103 |
| Molecular Formula | C18H18F2N4O3S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-[3-(difluoromethoxy)phenyl]-4-(4-nitrophenyl)piperazine-1-carbothioamide |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(C(=S)Nc3cccc(OC(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C18H18F2N4O3S/c19-17(20)27-16-3-1-2-13(12-16)21-18(28)23-10-8-22(9-11-23)14-4-6-15(7-5-14)24(25)26/h1-7,12,17H,8-11H2,(H,21,28) |
| InChIKey | OCAGNXKOIJDMDM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|