C19H23N3O2S — CID 3839532
N,4-bis(3-methoxyphenyl)piperazine-1-carbothioamide (PubChem CID 3839532) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is N,4-bis(3-methoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | N,4-bis(3-methoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3839532 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N,4-bis(3-methoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1cccc(NC(=S)N2CCN(c3cccc(OC)c3)CC2)c1 |
| InChI | InChI=1S/C19H23N3O2S/c1-23-17-7-3-5-15(13-17)20-19(25)22-11-9-21(10-12-22)16-6-4-8-18(14-16)24-2/h3-8,13-14H,9-12H2,1-2H3,(H,20,25) |
| InChIKey | SCUXMGRHHVXBCG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|