C20H24ClN3O3S — CID 3547091
N-(4-chloro-2,5-dimethoxyphenyl)-4-(3-methoxyphenyl)piperazine-1-carbothioamide (PubChem CID 3547091) has the molecular formula C20H24ClN3O3S and a molecular weight of 421.95 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-4-(3-methoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-(3-methoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3547091 |
| Molecular Formula | C20H24ClN3O3S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-(3-methoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1cccc(N2CCN(C(=S)Nc3cc(OC)c(Cl)cc3OC)CC2)c1 |
| InChI | InChI=1S/C20H24ClN3O3S/c1-25-15-6-4-5-14(11-15)23-7-9-24(10-8-23)20(28)22-17-13-18(26-2)16(21)12-19(17)27-3/h4-6,11-13H,7-10H2,1-3H3,(H,22,28) |
| InChIKey | QRZLWRHUBPAESI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|