C19H21Cl2N3O2S — CID 19654680
4-(3,4-dichlorophenyl)-N-(3,5-dimethoxyphenyl)piperazine-1-carbothioamide (PubChem CID 19654680) has the molecular formula C19H21Cl2N3O2S and a molecular weight of 426.37 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-(3,5-dimethoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-(3,4-dichlorophenyl)-N-(3,5-dimethoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19654680 |
| Molecular Formula | C19H21Cl2N3O2S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-(3,5-dimethoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1cc(NC(=S)N2CCN(c3ccc(Cl)c(Cl)c3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C19H21Cl2N3O2S/c1-25-15-9-13(10-16(12-15)26-2)22-19(27)24-7-5-23(6-8-24)14-3-4-17(20)18(21)11-14/h3-4,9-12H,5-8H2,1-2H3,(H,22,27) |
| InChIKey | WGZQECCYZMYYGQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|