C15H21Cl2N3OS — CID 2170839
4-(3,4-dichlorophenyl)-N-(3-methoxypropyl)piperazine-1-carbothioamide (PubChem CID 2170839) has the molecular formula C15H21Cl2N3OS and a molecular weight of 362.33 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-(3-methoxypropyl)piperazine-1-carbothioamide.
| Compound Name | 4-(3,4-dichlorophenyl)-N-(3-methoxypropyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2170839 |
| Molecular Formula | C15H21Cl2N3OS |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-(3-methoxypropyl)piperazine-1-carbothioamide |
| SMILES | COCCCNC(=S)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H21Cl2N3OS/c1-21-10-2-5-18-15(22)20-8-6-19(7-9-20)12-3-4-13(16)14(17)11-12/h3-4,11H,2,5-10H2,1H3,(H,18,22) |
| InChIKey | IJPHYLWOEDOYJS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|