C16H23Cl2N3OS — CID 4770339
4-[(3,4-dichlorophenyl)methyl]-N-(3-methoxypropyl)piperazine-1-carbothioamide (PubChem CID 4770339) has the molecular formula C16H23Cl2N3OS and a molecular weight of 376.35 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl]-N-(3-methoxypropyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl]-N-(3-methoxypropyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 4770339 |
| Molecular Formula | C16H23Cl2N3OS |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl]-N-(3-methoxypropyl)piperazine-1-carbothioamide |
| SMILES | COCCCNC(=S)N1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H23Cl2N3OS/c1-22-10-2-5-19-16(23)21-8-6-20(7-9-21)12-13-3-4-14(17)15(18)11-13/h3-4,11H,2,5-10,12H2,1H3,(H,19,23) |
| InChIKey | PTQOLGNKDLNYFT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|