C24H31Cl2N3O2S — CID 19574564
4-[(3,4-dichlorophenyl)methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]piperazine-1-carbothioamide (PubChem CID 19574564) has the molecular formula C24H31Cl2N3O2S and a molecular weight of 496.50 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]piperazine-1-carbothioamide.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19574564 |
| Molecular Formula | C24H31Cl2N3O2S |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]piperazine-1-carbothioamide |
| SMILES | CCOc1ccc(CCNC(=S)N2CCN(Cc3ccc(Cl)c(Cl)c3)CC2)cc1OCC |
| InChI | InChI=1S/C24H31Cl2N3O2S/c1-3-30-22-8-6-18(16-23(22)31-4-2)9-10-27-24(32)29-13-11-28(12-14-29)17-19-5-7-20(25)21(26)15-19/h5-8,15-16H,3-4,9-14,17H2,1-2H3,(H,27,32) |
| InChIKey | LFGVKFNORQAFCU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|