C18H17Cl4N3S — CID 19574561
N-(2,5-dichlorophenyl)-4-[(3,4-dichlorophenyl)methyl]piperazine-1-carbothioamide (PubChem CID 19574561) has the molecular formula C18H17Cl4N3S and a molecular weight of 449.23 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-[(3,4-dichlorophenyl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-(2,5-dichlorophenyl)-4-[(3,4-dichlorophenyl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19574561 |
| Molecular Formula | C18H17Cl4N3S |
| Molecular Weight | 449.23 g/mol |
| Exact Mass | 446.99 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-[(3,4-dichlorophenyl)methyl]piperazine-1-carbothioamide |
| SMILES | S=C(Nc1cc(Cl)ccc1Cl)N1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H17Cl4N3S/c19-13-2-4-15(21)17(10-13)23-18(26)25-7-5-24(6-8-25)11-12-1-3-14(20)16(22)9-12/h1-4,9-10H,5-8,11H2,(H,23,26) |
| InChIKey | CXCCRPTYGBTMIV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.23 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|