C18H20ClN3OS — CID 100569705
N-(2-chlorophenyl)-4-[(3-hydroxyphenyl)methyl]piperazine-1-carbothioamide (PubChem CID 100569705) has the molecular formula C18H20ClN3OS and a molecular weight of 361.90 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-[(3-hydroxyphenyl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-(2-chlorophenyl)-4-[(3-hydroxyphenyl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 100569705 |
| Molecular Formula | C18H20ClN3OS |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-(2-chlorophenyl)-4-[(3-hydroxyphenyl)methyl]piperazine-1-carbothioamide |
| SMILES | Oc1cccc(CN2CCN(C(=S)Nc3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C18H20ClN3OS/c19-16-6-1-2-7-17(16)20-18(24)22-10-8-21(9-11-22)13-14-4-3-5-15(23)12-14/h1-7,12,23H,8-11,13H2,(H,20,24) |
| InChIKey | SEDTUFLISPJLBO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|