C13H17Cl2N3S — CID 17262191
N-(2,3-dichlorophenyl)-4-ethylpiperazine-1-carbothioamide (PubChem CID 17262191) has the molecular formula C13H17Cl2N3S and a molecular weight of 318.27 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-4-ethylpiperazine-1-carbothioamide.
| Compound Name | N-(2,3-dichlorophenyl)-4-ethylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17262191 |
| Molecular Formula | C13H17Cl2N3S |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-4-ethylpiperazine-1-carbothioamide |
| SMILES | CCN1CCN(C(=S)Nc2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C13H17Cl2N3S/c1-2-17-6-8-18(9-7-17)13(19)16-11-5-3-4-10(14)12(11)15/h3-5H,2,6-9H2,1H3,(H,16,19) |
| InChIKey | MCNFCDHWSHPDND-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|