C13H18ClN3O2S2 — CID 970715
N-(3-chloro-2-methylphenyl)-4-methylsulfonylpiperazine-1-carbothioamide (PubChem CID 970715) has the molecular formula C13H18ClN3O2S2 and a molecular weight of 347.89 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-4-methylsulfonylpiperazine-1-carbothioamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-4-methylsulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 970715 |
| Molecular Formula | C13H18ClN3O2S2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-4-methylsulfonylpiperazine-1-carbothioamide |
| SMILES | Cc1c(Cl)cccc1NC(=S)N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C13H18ClN3O2S2/c1-10-11(14)4-3-5-12(10)15-13(20)16-6-8-17(9-7-16)21(2,18)19/h3-5H,6-9H2,1-2H3,(H,15,20) |
| InChIKey | MIVQFEJCBDNCBY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|