C15H19ClN2O2S — CID 8743351
methyl 1-[(3-chloro-2-methylphenyl)carbamothioyl]piperidine-4-carboxylate (PubChem CID 8743351) has the molecular formula C15H19ClN2O2S and a molecular weight of 326.85 g/mol. Its IUPAC name is methyl 1-[(3-chloro-2-methylphenyl)carbamothioyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(3-chloro-2-methylphenyl)carbamothioyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 8743351 |
| Molecular Formula | C15H19ClN2O2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | methyl 1-[(3-chloro-2-methylphenyl)carbamothioyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=S)Nc2cccc(Cl)c2C)CC1 |
| InChI | InChI=1S/C15H19ClN2O2S/c1-10-12(16)4-3-5-13(10)17-15(21)18-8-6-11(7-9-18)14(19)20-2/h3-5,11H,6-9H2,1-2H3,(H,17,21) |
| InChIKey | OJRHAARRUNTXKR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|