C17H17ClN4O3S2 — CID 43076989
N-(3-chloro-2-methylphenyl)-4-(5-nitrothiophene-2-carbonyl)piperazine-1-carbothioamide (PubChem CID 43076989) has the molecular formula C17H17ClN4O3S2 and a molecular weight of 424.94 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-4-(5-nitrothiophene-2-carbonyl)piperazine-1-carbothioamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-4-(5-nitrothiophene-2-carbonyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 43076989 |
| Molecular Formula | C17H17ClN4O3S2 |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-4-(5-nitrothiophene-2-carbonyl)piperazine-1-carbothioamide |
| SMILES | Cc1c(Cl)cccc1NC(=S)N1CCN(C(=O)c2ccc([N+](=O)[O-])s2)CC1 |
| InChI | InChI=1S/C17H17ClN4O3S2/c1-11-12(18)3-2-4-13(11)19-17(26)21-9-7-20(8-10-21)16(23)14-5-6-15(27-14)22(24)25/h2-6H,7-10H2,1H3,(H,19,26) |
| InChIKey | HVPFGHUJZJTLRM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|