C18H20N4O3S2 — CID 43076993
N-(3,4-dimethylphenyl)-4-(5-nitrothiophene-2-carbonyl)piperazine-1-carbothioamide (PubChem CID 43076993) has the molecular formula C18H20N4O3S2 and a molecular weight of 404.52 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-(5-nitrothiophene-2-carbonyl)piperazine-1-carbothioamide.
| Compound Name | N-(3,4-dimethylphenyl)-4-(5-nitrothiophene-2-carbonyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 43076993 |
| Molecular Formula | C18H20N4O3S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-(5-nitrothiophene-2-carbonyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCN(C(=O)c3ccc([N+](=O)[O-])s3)CC2)cc1C |
| InChI | InChI=1S/C18H20N4O3S2/c1-12-3-4-14(11-13(12)2)19-18(26)21-9-7-20(8-10-21)17(23)15-5-6-16(27-15)22(24)25/h3-6,11H,7-10H2,1-2H3,(H,19,26) |
| InChIKey | JMWFTHAEFZCIOS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|