C19H21N3O5S — CID 46464795
2-(2,5-dimethylphenoxy)-1-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]ethanone (PubChem CID 46464795) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-1-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2,5-dimethylphenoxy)-1-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 46464795 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-1-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(C)c(OCC(=O)N2CCN(C(=O)c3ccc([N+](=O)[O-])s3)CC2)c1 |
| InChI | InChI=1S/C19H21N3O5S/c1-13-3-4-14(2)15(11-13)27-12-17(23)20-7-9-21(10-8-20)19(24)16-5-6-18(28-16)22(25)26/h3-6,11H,7-10,12H2,1-2H3 |
| InChIKey | BOFSNMZJYDFMGG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|