C19H19N3O6S — CID 46464755
3-(1,3-benzodioxol-5-yl)-1-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]propan-1-one (PubChem CID 46464755) has the molecular formula C19H19N3O6S and a molecular weight of 417.44 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 46464755 |
| Molecular Formula | C19H19N3O6S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)N1CCN(C(=O)c2ccc([N+](=O)[O-])s2)CC1 |
| InChI | InChI=1S/C19H19N3O6S/c23-17(5-2-13-1-3-14-15(11-13)28-12-27-14)20-7-9-21(10-8-20)19(24)16-4-6-18(29-16)22(25)26/h1,3-4,6,11H,2,5,7-10,12H2 |
| InChIKey | ICVNILWHAHPNCS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|