C19H21N3O7S — CID 46464753
(5-nitrothiophen-2-yl)-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]methanone (PubChem CID 46464753) has the molecular formula C19H21N3O7S and a molecular weight of 435.46 g/mol. Its IUPAC name is (5-nitrothiophen-2-yl)-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]methanone.
| Compound Name | (5-nitrothiophen-2-yl)-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46464753 |
| Molecular Formula | C19H21N3O7S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (5-nitrothiophen-2-yl)-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)c3ccc([N+](=O)[O-])s3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21N3O7S/c1-27-13-10-12(11-14(28-2)17(13)29-3)18(23)20-6-8-21(9-7-20)19(24)15-4-5-16(30-15)22(25)26/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | FBAQAWCWFCHSLS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|