C21H22N4O6 — CID 56772561
5-nitro-2-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]benzonitrile (PubChem CID 56772561) has the molecular formula C21H22N4O6 and a molecular weight of 426.43 g/mol. Its IUPAC name is 5-nitro-2-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]benzonitrile.
| Compound Name | 5-nitro-2-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 56772561 |
| Molecular Formula | C21H22N4O6 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 5-nitro-2-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]benzonitrile |
| SMILES | COc1cc(C(=O)N2CCN(c3ccc([N+](=O)[O-])cc3C#N)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C21H22N4O6/c1-29-18-11-14(12-19(30-2)20(18)31-3)21(26)24-8-6-23(7-9-24)17-5-4-16(25(27)28)10-15(17)13-22/h4-5,10-12H,6-9H2,1-3H3 |
| InChIKey | GKMMDCFPAMAXLF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 118.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|