C30H33N5O6 — CID 5187660
[3-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-5-nitrophenyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 5187660) has the molecular formula C30H33N5O6 and a molecular weight of 559.62 g/mol. Its IUPAC name is [3-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-5-nitrophenyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [3-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-5-nitrophenyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 5187660 |
| Molecular Formula | C30H33N5O6 |
| Molecular Weight | 559.62 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | [3-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-5-nitrophenyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccccc1N1CCN(C(=O)c2cc(C(=O)N3CCN(c4ccccc4OC)CC3)cc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C30H33N5O6/c1-40-27-9-5-3-7-25(27)31-11-15-33(16-12-31)29(36)22-19-23(21-24(20-22)35(38)39)30(37)34-17-13-32(14-18-34)26-8-4-6-10-28(26)41-2/h3-10,19-21H,11-18H2,1-2H3 |
| InChIKey | NVJTURWMVKAVFR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 108.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.62 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|