C18H20N2O4 — CID 113199237
(3,4-dihydroxyphenyl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 113199237) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is (3,4-dihydroxyphenyl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | (3,4-dihydroxyphenyl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 113199237 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (3,4-dihydroxyphenyl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccccc1N1CCN(C(=O)c2ccc(O)c(O)c2)CC1 |
| InChI | InChI=1S/C18H20N2O4/c1-24-17-5-3-2-4-14(17)19-8-10-20(11-9-19)18(23)13-6-7-15(21)16(22)12-13/h2-7,12,21-22H,8-11H2,1H3 |
| InChIKey | YCXBSENTMPPWKK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|