C22H27N3O7 — CID 5131579
[4-(2-methoxy-4-nitroanilino)piperidin-1-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 5131579) has the molecular formula C22H27N3O7 and a molecular weight of 445.47 g/mol. Its IUPAC name is [4-(2-methoxy-4-nitroanilino)piperidin-1-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [4-(2-methoxy-4-nitroanilino)piperidin-1-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 5131579 |
| Molecular Formula | C22H27N3O7 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | [4-(2-methoxy-4-nitroanilino)piperidin-1-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC1CCN(C(=O)c2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C22H27N3O7/c1-29-18-13-16(25(27)28)5-6-17(18)23-15-7-9-24(10-8-15)22(26)14-11-19(30-2)21(32-4)20(12-14)31-3/h5-6,11-13,15,23H,7-10H2,1-4H3 |
| InChIKey | PZNUKLMGFXLUKR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|