C15H18N2O7 — CID 119349917
1-(3,4-dimethoxy-5-nitrobenzoyl)piperidine-4-carboxylic acid (PubChem CID 119349917) has the molecular formula C15H18N2O7 and a molecular weight of 338.32 g/mol. Its IUPAC name is 1-(3,4-dimethoxy-5-nitrobenzoyl)piperidine-4-carboxylic acid.
| Compound Name | 1-(3,4-dimethoxy-5-nitrobenzoyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119349917 |
| Molecular Formula | C15H18N2O7 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 1-(3,4-dimethoxy-5-nitrobenzoyl)piperidine-4-carboxylic acid |
| SMILES | COc1cc(C(=O)N2CCC(C(=O)O)CC2)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C15H18N2O7/c1-23-12-8-10(7-11(17(21)22)13(12)24-2)14(18)16-5-3-9(4-6-16)15(19)20/h7-9H,3-6H2,1-2H3,(H,19,20) |
| InChIKey | NTVJMBUEYRDBMX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|