C20H22FN3O5 — CID 133307998
(3,4-dimethoxyphenyl)-[4-(3-fluoro-2-nitroanilino)piperidin-1-yl]methanone (PubChem CID 133307998) has the molecular formula C20H22FN3O5 and a molecular weight of 403.41 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[4-(3-fluoro-2-nitroanilino)piperidin-1-yl]methanone.
| Compound Name | (3,4-dimethoxyphenyl)-[4-(3-fluoro-2-nitroanilino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 133307998 |
| Molecular Formula | C20H22FN3O5 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[4-(3-fluoro-2-nitroanilino)piperidin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCC(Nc3cccc(F)c3[N+](=O)[O-])CC2)cc1OC |
| InChI | InChI=1S/C20H22FN3O5/c1-28-17-7-6-13(12-18(17)29-2)20(25)23-10-8-14(9-11-23)22-16-5-3-4-15(21)19(16)24(26)27/h3-7,12,14,22H,8-11H2,1-2H3 |
| InChIKey | WASKXIOZINHGLM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|