C18H14Cl2N4O3 — CID 56772537
2-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-5-nitrobenzonitrile (PubChem CID 56772537) has the molecular formula C18H14Cl2N4O3 and a molecular weight of 405.24 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-5-nitrobenzonitrile.
| Compound Name | 2-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 56772537 |
| Molecular Formula | C18H14Cl2N4O3 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 2-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1N1CCN(C(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H14Cl2N4O3/c19-15-3-1-12(10-16(15)20)18(25)23-7-5-22(6-8-23)17-4-2-14(24(26)27)9-13(17)11-21/h1-4,9-10H,5-8H2 |
| InChIKey | HBOLBLBDZJWYAL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|