C20H16Cl2N4O3 — CID 2866417
(3,4-dichlorophenyl)-[4-(5-nitroquinolin-8-yl)piperazin-1-yl]methanone (PubChem CID 2866417) has the molecular formula C20H16Cl2N4O3 and a molecular weight of 431.28 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[4-(5-nitroquinolin-8-yl)piperazin-1-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[4-(5-nitroquinolin-8-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 2866417 |
| Molecular Formula | C20H16Cl2N4O3 |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | (3,4-dichlorophenyl)-[4-(5-nitroquinolin-8-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N1CCN(c2ccc([N+](=O)[O-])c3cccnc23)CC1 |
| InChI | InChI=1S/C20H16Cl2N4O3/c21-15-4-3-13(12-16(15)22)20(27)25-10-8-24(9-11-25)18-6-5-17(26(28)29)14-2-1-7-23-19(14)18/h1-7,12H,8-11H2 |
| InChIKey | YCEJGRMFIFNIPY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|