C18H18N2O4 — CID 18102373
2-(2,5-dimethylphenoxy)-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 18102373) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-(2,5-dimethylphenoxy)-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 18102373 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | Cc1ccc(C)c(OCC(=O)N2CCc3cc([N+](=O)[O-])ccc32)c1 |
| InChI | InChI=1S/C18H18N2O4/c1-12-3-4-13(2)17(9-12)24-11-18(21)19-8-7-14-10-15(20(22)23)5-6-16(14)19/h3-6,9-10H,7-8,11H2,1-2H3 |
| InChIKey | LZUKOTDCKQERTQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|