C21H16N2O5 — CID 27310345
2-[2-(5-nitro-2,3-dihydroindol-1-yl)-2-oxoethoxy]naphthalene-1-carbaldehyde (PubChem CID 27310345) has the molecular formula C21H16N2O5 and a molecular weight of 376.37 g/mol. Its IUPAC name is 2-[2-(5-nitro-2,3-dihydroindol-1-yl)-2-oxoethoxy]naphthalene-1-carbaldehyde.
| Compound Name | 2-[2-(5-nitro-2,3-dihydroindol-1-yl)-2-oxoethoxy]naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 27310345 |
| Molecular Formula | C21H16N2O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-[2-(5-nitro-2,3-dihydroindol-1-yl)-2-oxoethoxy]naphthalene-1-carbaldehyde |
| SMILES | O=Cc1c(OCC(=O)N2CCc3cc([N+](=O)[O-])ccc32)ccc2ccccc12 |
| InChI | InChI=1S/C21H16N2O5/c24-12-18-17-4-2-1-3-14(17)5-8-20(18)28-13-21(25)22-10-9-15-11-16(23(26)27)6-7-19(15)22/h1-8,11-12H,9-10,13H2 |
| InChIKey | DINXJFVFZURPNA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|