C17H15N3O6 — CID 27190512
2-(3-methyl-4-nitrophenoxy)-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 27190512) has the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. Its IUPAC name is 2-(3-methyl-4-nitrophenoxy)-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-(3-methyl-4-nitrophenoxy)-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 27190512 |
| Molecular Formula | C17H15N3O6 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-(3-methyl-4-nitrophenoxy)-1-(5-nitro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | Cc1cc(OCC(=O)N2CCc3cc([N+](=O)[O-])ccc32)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15N3O6/c1-11-8-14(3-5-15(11)20(24)25)26-10-17(21)18-7-6-12-9-13(19(22)23)2-4-16(12)18/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | YMZKLNZEAWMKGX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|