C21H18N2O6 — CID 27311229
4-methyl-7-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]chromen-2-one (PubChem CID 27311229) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is 4-methyl-7-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]chromen-2-one.
| Compound Name | 4-methyl-7-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 27311229 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 4-methyl-7-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)N3CCCc4cc([N+](=O)[O-])ccc43)ccc12 |
| InChI | InChI=1S/C21H18N2O6/c1-13-9-21(25)29-19-11-16(5-6-17(13)19)28-12-20(24)22-8-2-3-14-10-15(23(26)27)4-7-18(14)22/h4-7,9-11H,2-3,8,12H2,1H3 |
| InChIKey | OEEHEQCDPPAJCU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 102.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|