C18H15N3O7 — CID 27310246
[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 4-nitrobenzoate (PubChem CID 27310246) has the molecular formula C18H15N3O7 and a molecular weight of 385.33 g/mol. Its IUPAC name is [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 4-nitrobenzoate.
| Compound Name | [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 27310246 |
| Molecular Formula | C18H15N3O7 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 4-nitrobenzoate |
| SMILES | O=C(OCC(=O)N1CCCc2cc([N+](=O)[O-])ccc21)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15N3O7/c22-17(11-28-18(23)12-3-5-14(6-4-12)20(24)25)19-9-1-2-13-10-15(21(26)27)7-8-16(13)19/h3-8,10H,1-2,9,11H2 |
| InChIKey | RKVLWRAOIDARCD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|