C17H14ClN3O5 — CID 27310580
[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 27310580) has the molecular formula C17H14ClN3O5 and a molecular weight of 375.77 g/mol. Its IUPAC name is [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 27310580 |
| Molecular Formula | C17H14ClN3O5 |
| Molecular Weight | 375.77 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | O=C(OCC(=O)N1CCCc2cc([N+](=O)[O-])ccc21)c1cccnc1Cl |
| InChI | InChI=1S/C17H14ClN3O5/c18-16-13(4-1-7-19-16)17(23)26-10-15(22)20-8-2-3-11-9-12(21(24)25)5-6-14(11)20/h1,4-7,9H,2-3,8,10H2 |
| InChIKey | QXBIVDKWSPWJFV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|