C22H20N4O6S — CID 26968537
[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]pyridine-3-carboxylate (PubChem CID 26968537) has the molecular formula C22H20N4O6S and a molecular weight of 468.49 g/mol. Its IUPAC name is [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]pyridine-3-carboxylate.
| Compound Name | [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 26968537 |
| Molecular Formula | C22H20N4O6S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]pyridine-3-carboxylate |
| SMILES | Cc1cc(CSc2ncccc2C(=O)OCC(=O)N2CCCc3cc([N+](=O)[O-])ccc32)no1 |
| InChI | InChI=1S/C22H20N4O6S/c1-14-10-16(24-32-14)13-33-21-18(5-2-8-23-21)22(28)31-12-20(27)25-9-3-4-15-11-17(26(29)30)6-7-19(15)25/h2,5-8,10-11H,3-4,9,12-13H2,1H3 |
| InChIKey | YUZYBWKDIDKSMQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 128.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|