C26H23N3O6 — CID 46644934
[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate (PubChem CID 46644934) has the molecular formula C26H23N3O6 and a molecular weight of 473.49 g/mol. Its IUPAC name is [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate.
| Compound Name | [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 46644934 |
| Molecular Formula | C26H23N3O6 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate |
| SMILES | O=C(Cc1ccccc1)Nc1ccccc1C(=O)OCC(=O)N1CCCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C26H23N3O6/c30-24(15-18-7-2-1-3-8-18)27-22-11-5-4-10-21(22)26(32)35-17-25(31)28-14-6-9-19-16-20(29(33)34)12-13-23(19)28/h1-5,7-8,10-13,16H,6,9,14-15,17H2,(H,27,30) |
| InChIKey | GSTKXAJEGKTOLU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|