C25H22N2O4 — CID 7835824
[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-benzamidobenzoate (PubChem CID 7835824) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-benzamidobenzoate.
| Compound Name | [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-benzamidobenzoate |
|---|---|
| PubChem CID | 7835824 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-benzamidobenzoate |
| SMILES | O=C(Nc1ccccc1C(=O)OCC(=O)N1CCCc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O4/c28-23(27-16-8-12-18-9-4-7-15-22(18)27)17-31-25(30)20-13-5-6-14-21(20)26-24(29)19-10-2-1-3-11-19/h1-7,9-11,13-15H,8,12,16-17H2,(H,26,29) |
| InChIKey | PTTGRRCBRHUBMV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |