C18H18N2O3 — CID 2542921
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-(methylamino)benzoate (PubChem CID 2542921) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-(methylamino)benzoate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-(methylamino)benzoate |
|---|---|
| PubChem CID | 2542921 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H18N2O3/c1-19-15-8-4-3-7-14(15)18(22)23-12-17(21)20-11-10-13-6-2-5-9-16(13)20/h2-9,19H,10-12H2,1H3 |
| InChIKey | ZYVBWXNLICXPPM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |