C21H17NO5 — CID 4693287
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 4693287) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 4693287 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCc2ccccc21)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C21H17NO5/c23-18-11-16(20(25)15-7-3-2-6-14(15)18)21(26)27-12-19(24)22-10-9-13-5-1-4-8-17(13)22/h1-8,11,23,25H,9-10,12H2 |
| InChIKey | JSZMEWZBHFIHGW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|