C17H13Cl2NO3 — CID 2467912
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2,6-dichlorobenzoate (PubChem CID 2467912) has the molecular formula C17H13Cl2NO3 and a molecular weight of 350.20 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2,6-dichlorobenzoate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 2467912 |
| Molecular Formula | C17H13Cl2NO3 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2,6-dichlorobenzoate |
| SMILES | O=C(OCC(=O)N1CCc2ccccc21)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H13Cl2NO3/c18-12-5-3-6-13(19)16(12)17(22)23-10-15(21)20-9-8-11-4-1-2-7-14(11)20/h1-7H,8-10H2 |
| InChIKey | GUYCXFQWNWHBJC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |